CAS 1823324-74-8 is the registry number for 4,6-Difluoro-1-methyl-1h-indole-5-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4,6-difluoro-1-methylindole-5-carbaldehyde (CAS 1823324-74-8) is a chemical compound with the molecular formula C10H7F2NO and a molecular weight of 195.16 g/mol. IUPAC name: 4,6-difluoro-1-methylindole-5-carbaldehyde. InChIKey: NEXOMCORLFUQOE-UHFFFAOYSA-N.
| Molecular formula | C10H7F2NO |
|---|---|
| Molecular weight | 195.16 g/mol |
| IUPAC name | 4,6-difluoro-1-methylindole-5-carbaldehyde |
| InChIKey | NEXOMCORLFUQOE-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C(C(=C(C=C21)F)C=O)F |
Computed by PubChem (NCBI)