Products 1206885-52-0
CAS 1206885-52-0 is the registry number for 1-(Difluoromethyl)-1h-indole-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(difluoromethyl)indole-3-carbaldehyde (CAS 1206885-52-0) is a chemical compound with the molecular formula C10H7F2NO and a molecular weight of 195.16 g/mol. IUPAC name: 1-(difluoromethyl)indole-3-carbaldehyde. InChIKey: DUXMZRFDEWARBJ-UHFFFAOYSA-N.
| Molecular formula | C10H7F2NO |
|---|---|
| Molecular weight | 195.16 g/mol |
| IUPAC name | 1-(difluoromethyl)indole-3-carbaldehyde |
| InChIKey | DUXMZRFDEWARBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2C(F)F)C=O |
Computed by PubChem (NCBI)