Products 587885-87-8
CAS 587885-87-8 is the registry number for 8-Bromo-2-(trifluoromethyl)quinolin-4(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-2-(trifluoromethyl)-1H-quinolin-4-one (CAS 587885-87-8) is a chemical compound with the molecular formula C10H5BrF3NO and a molecular weight of 292.05 g/mol. IUPAC name: 8-bromo-2-(trifluoromethyl)-1H-quinolin-4-one. InChIKey: WVDMDQACCBVSTK-UHFFFAOYSA-N.
| Molecular formula | C10H5BrF3NO |
|---|---|
| Molecular weight | 292.05 g/mol |
| IUPAC name | 8-bromo-2-(trifluoromethyl)-1H-quinolin-4-one |
| InChIKey | WVDMDQACCBVSTK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC(=CC2=O)C(F)(F)F |
Computed by PubChem (NCBI)