Products 587886-26-8
CAS 587886-26-8 is the registry number for 2-(Trifluoromethyl)quinoline-3-carboxylic acid, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(trifluoromethyl)quinoline-3-carboxylic acid (CAS 587886-26-8) is a chemical compound with the molecular formula C11H6F3NO2 and a molecular weight of 241.17 g/mol. IUPAC name: 2-(trifluoromethyl)quinoline-3-carboxylic acid. InChIKey: VIUDHZOBRHLGGI-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO2 |
|---|---|
| Molecular weight | 241.17 g/mol |
| IUPAC name | 2-(trifluoromethyl)quinoline-3-carboxylic acid |
| InChIKey | VIUDHZOBRHLGGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=N2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)