CAS 58793-86-5 is the registry number for Methyl 2,5,9-Trimethyldeca-2,4,8-trienoate. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
Methyl (2E,4E)-2,5,9-trimethyldeca-2,4,8-trienoate (CAS 58793-86-5) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: methyl (2E,4E)-2,5,9-trimethyldeca-2,4,8-trienoate. InChIKey: WKDBKZMIVPJULY-JOWSBRCASA-N.
| Molecular formula | C14H22O2 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | methyl (2E,4E)-2,5,9-trimethyldeca-2,4,8-trienoate |
| InChIKey | WKDBKZMIVPJULY-JOWSBRCASA-N |
| SMILES | CC(=CCC/C(=C/C=C(\C)/C(=O)OC)/C)C |
Computed by PubChem (NCBI)