CAS 58810-67-6 appears in our catalog under these names: cis-4-Aminochroman-3-ol, 95%, rac-(3R,4R)-4-Amino-3,4-dihydro-2H-1-benzopyran-3-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(3S,4S)-4-amino-3,4-dihydro-2H-chromen-3-ol (CAS 58810-67-6) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: (3S,4S)-4-amino-3,4-dihydro-2H-chromen-3-ol. InChIKey: JVPRWKWUBCZNJO-APPZFPTMSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | (3S,4S)-4-amino-3,4-dihydro-2H-chromen-3-ol |
| InChIKey | JVPRWKWUBCZNJO-APPZFPTMSA-N |
| SMILES | C1[C@H]([C@H](C2=CC=CC=C2O1)N)O |
Computed by PubChem (NCBI)