CAS 58810-68-7 appears in our catalog under these names: trans-4-Aminochroman-3-ol, 95+%, rac-(3R,4S)-4-Amino-3,4-dihydro-2H-1-benzopyran-3-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(3R,4S)-4-amino-3,4-dihydro-2H-chromen-3-ol (CAS 58810-68-7) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: (3R,4S)-4-amino-3,4-dihydro-2H-chromen-3-ol. InChIKey: JVPRWKWUBCZNJO-CBAPKCEASA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | (3R,4S)-4-amino-3,4-dihydro-2H-chromen-3-ol |
| InChIKey | JVPRWKWUBCZNJO-CBAPKCEASA-N |
| SMILES | C1[C@@H]([C@H](C2=CC=CC=C2O1)N)O |
Computed by PubChem (NCBI)