CAS 58884-35-8 appears in our catalog under these names: 4–(6–Methyl–1,2,4,5–tetrazin–3–yl)phenol, 4-(6-Methyl-1,2,4,5-tetrazin-3-yl)phenol, 4-(6-Methyl-1,2,4,5-tetrazin-3-yl)phenol, 96%, 96%, 4-(6-Methyl-1,2,4,5-tetrazin-3-yl)phenol, 98.10%, 4-(6-Methyl-1,2,4,5-tetrazin-3-yl)phenol, 95%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 500mg, 1g, 0,5g, 2g, 100mg, 5g, 100 mg.
4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenol (CAS 58884-35-8) is a chemical compound with the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. IUPAC name: 4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenol. InChIKey: WQYZHGNJBULAME-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O |
|---|---|
| Molecular weight | 188.19 g/mol |
| IUPAC name | 4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenol |
| InChIKey | WQYZHGNJBULAME-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N=N1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)