Products 58962-95-1
CAS 58962-95-1 is the registry number for WAY-639359-10mMinDMSO,,, ≥95%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg.
(2-methylindolizin-3-yl)-pyridin-3-ylmethanone (CAS 58962-95-1) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: (2-methylindolizin-3-yl)-pyridin-3-ylmethanone. InChIKey: SXYDYYKZXHIRKW-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | (2-methylindolizin-3-yl)-pyridin-3-ylmethanone |
| InChIKey | SXYDYYKZXHIRKW-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=CC=CC2=C1)C(=O)C3=CN=CC=C3 |
Computed by PubChem (NCBI)