Products 59080-37-4
CAS 59080-37-4 appears in our catalog under these names: PBB No. 52, PBB 52. Offered by: Dr. Ehrenstorfer, Biosynth. Available pack sizes: 10mg, 250mg, 100mg.
1,4-dibromo-2-(2,5-dibromophenyl)benzene (CAS 59080-37-4) is a chemical compound with the molecular formula C12H6Br4 and a molecular weight of 469.79 g/mol. IUPAC name: 1,4-dibromo-2-(2,5-dibromophenyl)benzene. InChIKey: XEFMFJLRXHQLEM-UHFFFAOYSA-N.
| Molecular formula | C12H6Br4 |
|---|---|
| Molecular weight | 469.79 g/mol |
| IUPAC name | 1,4-dibromo-2-(2,5-dibromophenyl)benzene |
| InChIKey | XEFMFJLRXHQLEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C2=C(C=CC(=C2)Br)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
2,2',5,5'-Tetrabromobiphenyl, 1,4-dibromo-2-(2,5-dibromophenyl)benzene, PBB No. 52, PBB-No. 52, 2,2',5,5'-Tetrabromobiphenyl (PBB 52), 2,2',5,5'-Tetrabromo-1,1'-biphenyl, PBB-No. 52 10 |Ig/mL in Acetonitrile, 1,1-Biphenyl, 2,2',5,5'-tetrabromo-, 2,2',5,5'-Tetrabromo-1,1'-biphenyl #, InChI=1/C12H6Br4/c13-7-1-3-11(15)9(5-7)10-6-8(14)2-4-12(10)16/h1-6