CAS 97038-96-5 is the registry number for 2,2',6,6'-Tetrabromo-1,1'-biphenyl. Offered by: Biosynth. Available pack sizes: 1g.
1,3-dibromo-2-(2,6-dibromophenyl)benzene (CAS 97038-96-5) is a chemical compound with the molecular formula C12H6Br4 and a molecular weight of 469.79 g/mol. IUPAC name: 1,3-dibromo-2-(2,6-dibromophenyl)benzene. InChIKey: RAIZQBVLCDNAOH-UHFFFAOYSA-N.
| Molecular formula | C12H6Br4 |
|---|---|
| Molecular weight | 469.79 g/mol |
| IUPAC name | 1,3-dibromo-2-(2,6-dibromophenyl)benzene |
| InChIKey | RAIZQBVLCDNAOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C2=C(C=CC=C2Br)Br)Br |
Computed by PubChem (NCBI)