Products 59589-92-3
CAS 59589-92-3 is the registry number for 1,2,3-Tribromo-5-(4-bromophenyl)benzene. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
1,2,3-tribromo-5-(4-bromophenyl)benzene (CAS 59589-92-3) is a chemical compound with the molecular formula C12H6Br4 and a molecular weight of 469.79 g/mol. IUPAC name: 1,2,3-tribromo-5-(4-bromophenyl)benzene. InChIKey: BQOPMOAYELIJRL-UHFFFAOYSA-N.
| Molecular formula | C12H6Br4 |
|---|---|
| Molecular weight | 469.79 g/mol |
| IUPAC name | 1,2,3-tribromo-5-(4-bromophenyl)benzene |
| InChIKey | BQOPMOAYELIJRL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C(=C2)Br)Br)Br)Br |
Computed by PubChem (NCBI)