CAS 59090-48-1 appears in our catalog under these names: 5-(Azidomethyl)-2'-deoxyuridine, min. 95 %, 1 g, 5–Azidomethyl–2'–deoxyuridine, 5-(Azidomethyl)-2’-deoxyuridine, α-Azidothymidine 95%, 5-Azidomethyl-2'-deoxyuridine, 99.67%. Offered by: Roth, GLPBio, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 1g, 10mg, 25mg, 5mg, 50mg, 100mg, 1000mg, 250mg.
5-(azidomethyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 59090-48-1) is a chemical compound with the molecular formula C10H13N5O5 and a molecular weight of 283.24 g/mol. IUPAC name: 5-(azidomethyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: JKSAKMHLWMCADM-XLPZGREQSA-N.
| Molecular formula | C10H13N5O5 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 5-(azidomethyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | JKSAKMHLWMCADM-XLPZGREQSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=C(C(=O)NC2=O)CN=[N+]=[N-])CO)O |
Computed by PubChem (NCBI)