CAS 5918-97-8 is the registry number for 4-Chloro-1H-1,3-benzodiazol-2-ol. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-chloro-1,3-dihydrobenzimidazol-2-one (CAS 5918-97-8) is a chemical compound with the molecular formula C7H5ClN2O and a molecular weight of 168.58 g/mol. IUPAC name: 4-chloro-1,3-dihydrobenzimidazol-2-one. InChIKey: IDGCFJLWZBBNNC-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O |
|---|---|
| Molecular weight | 168.58 g/mol |
| IUPAC name | 4-chloro-1,3-dihydrobenzimidazol-2-one |
| InChIKey | IDGCFJLWZBBNNC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC(=O)N2 |
Computed by PubChem (NCBI)