CAS 59245-36-2 appears in our catalog under these names: Sapropterin Impurity 5, Sapropterin Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
(1E,2S,3S,4S)-1-(phenylhydrazinylidene)pentane-2,3,4-triol (CAS 59245-36-2) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. IUPAC name: (1E,2S,3S,4S)-1-(phenylhydrazinylidene)pentane-2,3,4-triol. InChIKey: BIVHIDUIIIYYKK-BOAFTQECSA-N.
| Molecular formula | C11H16N2O3 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | (1E,2S,3S,4S)-1-(phenylhydrazinylidene)pentane-2,3,4-triol |
| InChIKey | BIVHIDUIIIYYKK-BOAFTQECSA-N |
| SMILES | C[C@@H]([C@@H]([C@H](/C=N/NC1=CC=CC=C1)O)O)O |
Computed by PubChem (NCBI)