CAS 59256-52-9 appears in our catalog under these names: 3,6,9,12-Tetraoxatetradecane-1,14-diyl diacrylate, 95%, Bis–acrylate–PEG5, 2-Propenoic acid,3,6,9,12-tetraoxatetradecane-1,14-diyl ester (9CI), 95%, 95%, Bis-acrylate-PEG5, 14-(PROP-2-ENOYLOXY)-3,6,9,12-TETRAOXATETRADECAN-1-YL PROP-2-ENOATE, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 25 mg, 100 mg, 5 mg, 50 mg, 250 mg, 10 mg.
2-[2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate (CAS 59256-52-9) is a chemical compound with the molecular formula C16H26O8 and a molecular weight of 346.37 g/mol. IUPAC name: 2-[2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate. InChIKey: IJUOZEBZJUUBNX-UHFFFAOYSA-N.
| Molecular formula | C16H26O8 |
|---|---|
| Molecular weight | 346.37 g/mol |
| IUPAC name | 2-[2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
| InChIKey | IJUOZEBZJUUBNX-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCOCCOCCOCCOCCOC(=O)C=C |
Computed by PubChem (NCBI)