Products 865887-46-3
CAS 865887-46-3 appears in our catalog under these names: Oleuropeic acid 8–O–glucoside, Oleuropeic acid 8-o-glucoside, Oleuropeic acid 8-O-glucoside, 96.0%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 0,5mg, 2mg, 5mg, 10mg, 5 mg, 1 mg.
(4S)-4-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]cyclohexene-1-carboxylic acid (CAS 865887-46-3) is a chemical compound with the molecular formula C16H26O8 and a molecular weight of 346.37 g/mol. IUPAC name: (4S)-4-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]cyclohexene-1-carboxylic acid. InChIKey: RQEWNDZNKBUWDH-LREAXHOUSA-N.
| Molecular formula | C16H26O8 |
|---|---|
| Molecular weight | 346.37 g/mol |
| IUPAC name | (4S)-4-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]cyclohexene-1-carboxylic acid |
| InChIKey | RQEWNDZNKBUWDH-LREAXHOUSA-N |
| SMILES | CC(C)([C@H]1CCC(=CC1)C(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)