Products 76880-55-2
CAS 76880-55-2 is the registry number for (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,2R)-2-acetyloxy-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl] acetate (CAS 76880-55-2) is a chemical compound with the molecular formula C16H26O8 and a molecular weight of 346.37 g/mol. IUPAC name: [(1R,2R)-2-acetyloxy-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl] acetate. InChIKey: MMSXXHNYSBMWLI-AAVRWANBSA-N.
| Molecular formula | C16H26O8 |
|---|---|
| Molecular weight | 346.37 g/mol |
| IUPAC name | [(1R,2R)-2-acetyloxy-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl] acetate |
| InChIKey | MMSXXHNYSBMWLI-AAVRWANBSA-N |
| SMILES | CC(=O)O[C@H]([C@H]1COC(O1)(C)C)[C@@H]([C@H]2COC(O2)(C)C)OC(=O)C |
Computed by PubChem (NCBI)