CAS 59377-19-4 appears in our catalog under these names: 4–Phenoxyphenyl isocyanate, 4-Phenoxyphenyl Isocyanate, 4-Phenoxyphenylisocyanate 98%, 4-Phenoxyphenyl isocyanate, 98% , 4-Phenoxyphenyl Isocyanate, 98%+(GC-MS),RG. Offered by: GLPBio, Biosynth, Ambeed, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 25g.
1-isocyanato-4-phenoxybenzene (CAS 59377-19-4) is a chemical compound with the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. IUPAC name: 1-isocyanato-4-phenoxybenzene. InChIKey: PNBUGOFIKAHZRW-UHFFFAOYSA-N.
| Molecular formula | C13H9NO2 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 1-isocyanato-4-phenoxybenzene |
| InChIKey | PNBUGOFIKAHZRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)N=C=O |
Computed by PubChem (NCBI)