CAS 5951-67-7 appears in our catalog under these names: alpha-Elemene, α-Elemene. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 50mg, 100mg.
(6S)-6-ethenyl-6-methyl-1-propan-2-yl-3-propan-2-ylidenecyclohexene (CAS 5951-67-7) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: (6S)-6-ethenyl-6-methyl-1-propan-2-yl-3-propan-2-ylidenecyclohexene. InChIKey: QDUJKDRUFBJYSQ-OAHLLOKOSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (6S)-6-ethenyl-6-methyl-1-propan-2-yl-3-propan-2-ylidenecyclohexene |
| InChIKey | QDUJKDRUFBJYSQ-OAHLLOKOSA-N |
| SMILES | CC(C)C1=CC(=C(C)C)CC[C@@]1(C)C=C |
Computed by PubChem (NCBI)