CAS 5956-12-7 appears in our catalog under these names: Dehydrodeoxybaimuxinol, α-Agarofuran (7CI), alpha-Agarofuran. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
(1R,6S,9R)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene (CAS 5956-12-7) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: (1R,6S,9R)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene. InChIKey: ZLQADKTVJQXDIG-SNPRPXQTSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | (1R,6S,9R)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene |
| InChIKey | ZLQADKTVJQXDIG-SNPRPXQTSA-N |
| SMILES | CC1=CCC[C@@]2([C@]13C[C@@H](CC2)C(O3)(C)C)C |
Computed by PubChem (NCBI)