CAS 59660-68-3 is the registry number for 2-Mesitylpropan-2-ol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
2-(2,4,6-trimethylphenyl)propan-2-ol (CAS 59660-68-3) is a chemical compound with the molecular formula C12H18O and a molecular weight of 178.27 g/mol. IUPAC name: 2-(2,4,6-trimethylphenyl)propan-2-ol. InChIKey: JFDXATFYWOLYQQ-UHFFFAOYSA-N.
| Molecular formula | C12H18O |
|---|---|
| Molecular weight | 178.27 g/mol |
| IUPAC name | 2-(2,4,6-trimethylphenyl)propan-2-ol |
| InChIKey | JFDXATFYWOLYQQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(C)(C)O)C |
Computed by PubChem (NCBI)