Products 59660-68-3

CAS 59660-68-3 is the registry number for 2-Mesitylpropan-2-ol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2-(2,4,6-trimethylphenyl)propan-2-ol (CAS 59660-68-3) is a chemical compound with the molecular formula C12H18O and a molecular weight of 178.27 g/mol. IUPAC name: 2-(2,4,6-trimethylphenyl)propan-2-ol. InChIKey: JFDXATFYWOLYQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18O
Molecular weight178.27 g/mol
IUPAC name2-(2,4,6-trimethylphenyl)propan-2-ol
InChIKeyJFDXATFYWOLYQQ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)C)C(C)(C)O)C

Computed by PubChem (NCBI)