Products 59684-82-1
CAS 59684-82-1 is the registry number for rac-3-Hydroxy-N-methyl-isomorphinan, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
(1R,9R,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (CAS 59684-82-1) is a chemical compound with the molecular formula C17H23NO and a molecular weight of 257.37 g/mol. IUPAC name: (1R,9R,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol. InChIKey: JAQUASYNZVUNQP-DJIMGWMZSA-N.
| Molecular formula | C17H23NO |
|---|---|
| Molecular weight | 257.37 g/mol |
| IUPAC name | (1R,9R,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| InChIKey | JAQUASYNZVUNQP-DJIMGWMZSA-N |
| SMILES | CN1CC[C@]23CCCC[C@@H]2[C@H]1CC4=C3C=C(C=C4)O |
Computed by PubChem (NCBI)