Products 59699-82-0
CAS 59699-82-0 is the registry number for 13-Cis-retinoic acid ethyl ester. Offered by: Biosynth. Available pack sizes: 1000mg.
Ethyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (CAS 59699-82-0) is a chemical compound with the molecular formula C22H32O2 and a molecular weight of 328.5 g/mol. IUPAC name: ethyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate. InChIKey: ZELWYCSDHIFMOP-HAPIZUAHSA-N.
| Molecular formula | C22H32O2 |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | ethyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| InChIKey | ZELWYCSDHIFMOP-HAPIZUAHSA-N |
| SMILES | CCOC(=O)/C=C(/C)\C=C\C=C(/C)\C=C\C1=C(CCCC1(C)C)C |
Computed by PubChem (NCBI)