Products 86708-67-0
CAS 86708-67-0 appears in our catalog under these names: 9-cis Retinoic Acid Ethyl Ester, Ethyl 9-cis-Retinoate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
Ethyl (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (CAS 86708-67-0) is a chemical compound with the molecular formula C22H32O2 and a molecular weight of 328.5 g/mol. IUPAC name: ethyl (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate. InChIKey: ZELWYCSDHIFMOP-MTJYDOFUSA-N.
| Molecular formula | C22H32O2 |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | ethyl (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| InChIKey | ZELWYCSDHIFMOP-MTJYDOFUSA-N |
| SMILES | CCOC(=O)/C=C(\C)/C=C/C=C(/C)\C=C\C1=C(CCCC1(C)C)C |
Computed by PubChem (NCBI)