CAS 59794-57-9 is the registry number for 1,2-Dihydrocinnoline-3,4-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-dihydrocinnoline-3,4-dione (CAS 59794-57-9) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1,2-dihydrocinnoline-3,4-dione. InChIKey: XYYSYQXZORUJPN-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1,2-dihydrocinnoline-3,4-dione |
| InChIKey | XYYSYQXZORUJPN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=O)NN2 |
Computed by PubChem (NCBI)