Products 59795-47-0
CAS 59795-47-0 appears in our catalog under these names: [1,1'-Biphenyl]-2,2',5,5'-tetracarboxylic acid, 95%, 95%, [1,1'-Biphenyl]-2,2',5,5'-tetracarboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(2,5-dicarboxyphenyl)terephthalic acid (CAS 59795-47-0) is a chemical compound with the molecular formula C16H10O8 and a molecular weight of 330.24 g/mol. IUPAC name: 2-(2,5-dicarboxyphenyl)terephthalic acid. InChIKey: BPFVHHLYBQRNKE-UHFFFAOYSA-N.
| Molecular formula | C16H10O8 |
|---|---|
| Molecular weight | 330.24 g/mol |
| IUPAC name | 2-(2,5-dicarboxyphenyl)terephthalic acid |
| InChIKey | BPFVHHLYBQRNKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C2=C(C=CC(=C2)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)