CAS 59824-68-9 is the registry number for (S)-2,3,10,11A-Tetrahydro-1h-benzo[e]pyrrolo[1,2-a][1,4]diazepin-11(5h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(6aS)-5,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-6-one (CAS 59824-68-9) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: (6aS)-5,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-6-one. InChIKey: UPCFVLAXIRKPNN-NSHDSACASA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | (6aS)-5,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-6-one |
| InChIKey | UPCFVLAXIRKPNN-NSHDSACASA-N |
| SMILES | C1C[C@H]2C(=O)NC3=CC=CC=C3CN2C1 |
Computed by PubChem (NCBI)