CAS 861359-04-8 is the registry number for 1-(Indazol-1-yl)-2,2-dimethylpropan-1-one, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
1-indazol-1-yl-2,2-dimethylpropan-1-one (CAS 861359-04-8) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 1-indazol-1-yl-2,2-dimethylpropan-1-one. InChIKey: OEYKDPCWPCBYJC-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 1-indazol-1-yl-2,2-dimethylpropan-1-one |
| InChIKey | OEYKDPCWPCBYJC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)N1C2=CC=CC=C2C=N1 |
Computed by PubChem (NCBI)