CAS 64368-86-1 is the registry number for 2-Methyl-2,3,4,5-tetrahydro-1h-pyrido[4,3-b]indol-8-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-ol (CAS 64368-86-1) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-ol. InChIKey: RSJHRJVOENGKLA-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-ol |
| InChIKey | RSJHRJVOENGKLA-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)C3=C(N2)C=CC(=C3)O |
Computed by PubChem (NCBI)