CAS 59830-60-3 appears in our catalog under these names: Cbz-l-phenylalaninal, 95%, (S)–Benzyl (1–oxo–3–phenylpropan–2–yl)carbamate, (S)-Benzyl (1-oxo-3-phenylpropan-2-yl)carbamate. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
Benzyl N-[(2S)-1-oxo-3-phenylpropan-2-yl]carbamate (CAS 59830-60-3) is a chemical compound with the molecular formula C17H17NO3 and a molecular weight of 283.32 g/mol. IUPAC name: benzyl N-[(2S)-1-oxo-3-phenylpropan-2-yl]carbamate. InChIKey: HZDPJHOWPIVWMR-INIZCTEOSA-N.
| Molecular formula | C17H17NO3 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | benzyl N-[(2S)-1-oxo-3-phenylpropan-2-yl]carbamate |
| InChIKey | HZDPJHOWPIVWMR-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C=O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)