Products 59865-13-3
CAS 59865-13-3 appears in our catalog under these names: Cyclosporin A, min. 95 %, 10 g, Cyclosporin A (Cyclosporine), Cyclosporin A, >95% (HPLC), Cyclosporin A, 99%, Ciclosporin. Offered by: Roth, Chemat Brand, TRC, AmBeed, Mikromol. Available pack sizes: 10g, on request, 100mg, 1g, 25mg, 250mg, 200mg, 10mM (in 1ml dmso).
Cyclosporin A is a cyclic nonribosomal peptide of eleven amino acids; an immunosuppressant drug widely used in post-allogeneic organ transplant to reduce the activity of the patient's immune system, and therefore the risk of organ rejection. Also causes reversible inhibition of immunocompetent lymphocytes in the G0- and G1-phase of the cell cycle. It has a role as an anticoronaviral agent, a geroprotector, a metabolite, an immunosuppressive agent, an antifungal agent, an antirheumatic drug, an EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor, an anti-asthmatic drug, a dermatologic drug and a carcinogenic agent.
Source: ChEBI
| Molecular formula | C62H111N11O12 |
|---|---|
| Molecular weight | 1202.6 g/mol |
| IUPAC name | (3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(E,1R,2R)-1-hydroxy-2-methylhex-4-enyl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| InChIKey | PMATZTZNYRCHOR-CGLBZJNRSA-N |
| SMILES | CC[C@H]1C(=O)N(CC(=O)N([C@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N1)[C@@H]([C@H](C)C/C=C/C)O)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C |
Computed by PubChem (NCBI)
Synonyms:
cyclosporin A, Ciclosporin, cyclosporine, Sandimmune, Neoral, Sandimmun, Cyclosporine A, Ciclosporine, Neoplanta, Equoral