CAS 59893-28-6 appears in our catalog under these names: 5-(Butan-2-yl)-2-hydroxybenzaldehyde, 95%, 5-(Butan-2-yl)-2-hydroxybenzaldehyde, 90%, 5-(Butan-2-yl)-2-hydroxybenzaldehyde. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-butan-2-yl-2-hydroxybenzaldehyde (CAS 59893-28-6) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 5-butan-2-yl-2-hydroxybenzaldehyde. InChIKey: KKECZRYVNIFRRC-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 5-butan-2-yl-2-hydroxybenzaldehyde |
| InChIKey | KKECZRYVNIFRRC-UHFFFAOYSA-N |
| SMILES | CCC(C)C1=CC(=C(C=C1)O)C=O |
Computed by PubChem (NCBI)