CAS 599178-71-9 is the registry number for (S)-3-([1,1'-Biphenyl]-4-yl)-2-acetamidopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-acetamido-3-(4-phenylphenyl)propanoic acid (CAS 599178-71-9) is a chemical compound with the molecular formula C17H17NO3 and a molecular weight of 283.32 g/mol. IUPAC name: (2S)-2-acetamido-3-(4-phenylphenyl)propanoic acid. InChIKey: HDNGVBPPMAZUMI-INIZCTEOSA-N.
| Molecular formula | C17H17NO3 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | (2S)-2-acetamido-3-(4-phenylphenyl)propanoic acid |
| InChIKey | HDNGVBPPMAZUMI-INIZCTEOSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)