CAS 63024-50-0 appears in our catalog under these names: 3-((1,1'-Biphenyl)-4-yl)-2-acetamidopropanoic acid, 98%, 3–((1,1'–Biphenyl)–4–yl)–2–acetamidopropanoic acid, 3-([1,1'-Biphenyl]-4-yl)-2-acetamidopropanoic acid, 95%, 95%, 2-ACETAMIDO-3-(BIPHENYL-4-YL)PROPANOIC ACID, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-acetamido-3-(4-phenylphenyl)propanoic acid (CAS 63024-50-0) is a chemical compound with the molecular formula C17H17NO3 and a molecular weight of 283.32 g/mol. IUPAC name: 2-acetamido-3-(4-phenylphenyl)propanoic acid. InChIKey: HDNGVBPPMAZUMI-UHFFFAOYSA-N.
| Molecular formula | C17H17NO3 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | 2-acetamido-3-(4-phenylphenyl)propanoic acid |
| InChIKey | HDNGVBPPMAZUMI-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC1=CC=C(C=C1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)