CAS 59935-30-7 appears in our catalog under these names: L-Isoleucine-15N, 98% 10atom%15N, L–Isoleucine–15N, L-ISOLEUCINE-15N, 98 ATOM% 15N, 98%, L-Isoleucine-15N, ≥98 atom% 15N,≥98.5%, ≥98 atom% 15N,≥98.5%, L-Isoleucine-15N, 98.00%. Offered by: AmBeed, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1g, 10mg, 100mg, 25mg, 50mg, 500MG, 25 mg, 5 mg.
(2S,3S)-2-(15N)azanyl-3-methylpentanoic acid (CAS 59935-30-7) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 132.17 g/mol. IUPAC name: (2S,3S)-2-(15N)azanyl-3-methylpentanoic acid. InChIKey: AGPKZVBTJJNPAG-NNXLWEQRSA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 132.17 g/mol |
| IUPAC name | (2S,3S)-2-(15N)azanyl-3-methylpentanoic acid |
| InChIKey | AGPKZVBTJJNPAG-NNXLWEQRSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)[15NH2] |
Computed by PubChem (NCBI)