CAS 60058-16-4 appears in our catalog under these names: 4-Hydroxy-1,5-naphthyridin-2(1h)-one, 95%, 4-Hydroxy-1,5-naphthyridin-2(1H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4-hydroxy-1H-1,5-naphthyridin-2-one (CAS 60058-16-4) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 4-hydroxy-1H-1,5-naphthyridin-2-one. InChIKey: HQYPFQDZOGVWCZ-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 4-hydroxy-1H-1,5-naphthyridin-2-one |
| InChIKey | HQYPFQDZOGVWCZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CC(=O)N2)O)N=C1 |
Computed by PubChem (NCBI)