Products 60064-34-8
CAS 60064-34-8 appears in our catalog under these names: Ethyl 2-amino-4-chlorobenzoate, 98%, Ethyl 2-amino-4-chlorobenzoate 98%, Ethyl 2-amino-4-chlorobenzoate, 98%, 98%, Ethyl 2-amino-4-chlorobenzoate, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, 10g.
Ethyl 2-amino-4-chlorobenzoate (CAS 60064-34-8) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: ethyl 2-amino-4-chlorobenzoate. InChIKey: GRKFYIXWMUULEX-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | ethyl 2-amino-4-chlorobenzoate |
| InChIKey | GRKFYIXWMUULEX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)Cl)N |
Computed by PubChem (NCBI)