CAS 63291-39-4 appears in our catalog under these names: H-D-Phg-nh2 hydrochloride, 98%, (2R)–2–amino–2–phenylacetamide,hydrochloride, H-D-Phg-Nh2 HCl, 98%, 98%, (R)-2-amino-2-phenylacetamide hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g.
(2R)-2-amino-2-phenylacetamide;hydrochloride (CAS 63291-39-4) is a chemical compound with the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. IUPAC name: (2R)-2-amino-2-phenylacetamide;hydrochloride. InChIKey: LXOAFHGMXCFTOU-OGFXRTJISA-N.
| Molecular formula | C8H11ClN2O |
|---|---|
| Molecular weight | 186.64 g/mol |
| IUPAC name | (2R)-2-amino-2-phenylacetamide;hydrochloride |
| InChIKey | LXOAFHGMXCFTOU-OGFXRTJISA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)