Products 60102-89-8
CAS 60102-89-8 appears in our catalog under these names: (+)-Epieudesmin, ≥98%, ≥98%, (+)-Epieudesmin. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 20mg, 50mg, 1 mg, 10 mg, 5 mg.
(3R,3aR,6S,6aR)-3,6-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan (CAS 60102-89-8) is a chemical compound with the molecular formula C22H26O6 and a molecular weight of 386.4 g/mol. IUPAC name: (3R,3aR,6S,6aR)-3,6-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan. InChIKey: PEUUVVGQIVMSAW-WWLNLUSPSA-N.
| Molecular formula | C22H26O6 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | (3R,3aR,6S,6aR)-3,6-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan |
| InChIKey | PEUUVVGQIVMSAW-WWLNLUSPSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C=C4)OC)OC)OC |
Computed by PubChem (NCBI)