CAS 60124-80-3 is the registry number for STP-d6 Hydrochloride. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
1-[4-methyl-2,5-bis(trideuteriomethoxy)phenyl]propan-2-amine;hydrochloride (CAS 60124-80-3) is a chemical compound with the molecular formula C12H20ClNO2 and a molecular weight of 251.78 g/mol. IUPAC name: 1-[4-methyl-2,5-bis(trideuteriomethoxy)phenyl]propan-2-amine;hydrochloride. InChIKey: IPIMRNFGYPQKAM-SKCUOGQWSA-N.
| Molecular formula | C12H20ClNO2 |
|---|---|
| Molecular weight | 251.78 g/mol |
| IUPAC name | 1-[4-methyl-2,5-bis(trideuteriomethoxy)phenyl]propan-2-amine;hydrochloride |
| InChIKey | IPIMRNFGYPQKAM-SKCUOGQWSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=C(C=C1C)OC([2H])([2H])[2H])CC(C)N.Cl |
Computed by PubChem (NCBI)