CAS 6013-94-1 appears in our catalog under these names: 2,2-Dimethyl-1-(4-methylphenyl)propan-1-ol, 2,2-Dimethyl-1-(4-methylphenyl)propan-1-ol, 95%, 2,2-dimethyl-1-(p-tolyl)propan-1-ol, 95%, 95%. Offered by: Biosynth, AmBeed, Chemat. Available pack sizes: 0,5g, 50mg, 5g, 100mg, 250mg.
2,2-dimethyl-1-(4-methylphenyl)propan-1-ol (CAS 6013-94-1) is a chemical compound with the molecular formula C12H18O and a molecular weight of 178.27 g/mol. IUPAC name: 2,2-dimethyl-1-(4-methylphenyl)propan-1-ol. InChIKey: IPMLKFCCZQQKIS-UHFFFAOYSA-N.
| Molecular formula | C12H18O |
|---|---|
| Molecular weight | 178.27 g/mol |
| IUPAC name | 2,2-dimethyl-1-(4-methylphenyl)propan-1-ol |
| InChIKey | IPMLKFCCZQQKIS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C(C)(C)C)O |
Computed by PubChem (NCBI)