Products 6019-39-2
CAS 6019-39-2 appears in our catalog under these names: OAC-2, >97.0%(HPLC)(qNMR), N-(1H-Indol-5-yl)benzamide, >95% (HPLC), OAC2/ 99.76% (existing batch purity), OAC2, N-(1H-Indol-5-yl)benzamide. Offered by: TCI, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 25mg, 5mg, 10mg, 50mg, 100mg, 2,5g, 250mg, 1mg.
N-(1H-indol-5-yl)benzamide (CAS 6019-39-2) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: N-(1H-indol-5-yl)benzamide. InChIKey: JCAFGYWSIWYMOX-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | N-(1H-indol-5-yl)benzamide |
| InChIKey | JCAFGYWSIWYMOX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC3=C(C=C2)NC=C3 |
Computed by PubChem (NCBI)