CAS 603-51-0 is the registry number for N,N-Diphenylhydrazinecarboxamide, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
3-amino-1,1-diphenylurea (CAS 603-51-0) is a chemical compound with the molecular formula C13H13N3O and a molecular weight of 227.26 g/mol. IUPAC name: 3-amino-1,1-diphenylurea. InChIKey: VVVFQQJJJRFDTE-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 3-amino-1,1-diphenylurea |
| InChIKey | VVVFQQJJJRFDTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=O)NN |
Computed by PubChem (NCBI)