CAS 603-86-1 appears in our catalog under these names: 2–Chloro–6–nitrophenol, 2-Chloro-6-nitrophenol, 98% , 2-Chloro-6-nitrophenol, >98.0%(GC)(T), 2-Chloro-6-nitrophenol 97%, 2-Chloro-6-nitrophenol, 97+%, 97+%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g, 250mg, 10g, 100g, 500g.
2-chloro-6-nitrophenol (CAS 603-86-1) is a chemical compound with the molecular formula C6H4ClNO3 and a molecular weight of 173.55 g/mol. IUPAC name: 2-chloro-6-nitrophenol. InChIKey: ICCYFVWQNFMENX-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO3 |
|---|---|
| Molecular weight | 173.55 g/mol |
| IUPAC name | 2-chloro-6-nitrophenol |
| InChIKey | ICCYFVWQNFMENX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)