CAS 60346-40-9 appears in our catalog under these names: 2-Methoxy-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid, 95%, 5,6,7,8-Tetrahydro-2-methoxy-1-naphthalenecarboxylic acid (ACI), 98%, 98%, 6-METHOXYTETRALIN-5-CARBOXYLIC ACID, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
2-methoxy-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (CAS 60346-40-9) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 2-methoxy-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid. InChIKey: XCCRLEOPTMKRRF-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2-methoxy-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
| InChIKey | XCCRLEOPTMKRRF-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(CCCC2)C=C1)C(=O)O |
Computed by PubChem (NCBI)