CAS 6042-04-2 appears in our catalog under these names: L-Methionine p-nitroanilide, 95%, H–Met–pNA, H-L-Met-pNA, (S)-2-Amino-4-(methylthio)-N-(4-nitrophenyl)butanamide, 97%, 97%, L-Methionine p-nitroanilide, 98.0%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 500 mg, 1 g, 5 g, 5g.
(2S)-2-amino-4-methylsulfanyl-N-(4-nitrophenyl)butanamide (CAS 6042-04-2) is a chemical compound with the molecular formula C11H15N3O3S and a molecular weight of 269.32 g/mol. IUPAC name: (2S)-2-amino-4-methylsulfanyl-N-(4-nitrophenyl)butanamide. InChIKey: PLBWRAWSHVJPTL-JTQLQIEISA-N.
| Molecular formula | C11H15N3O3S |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | (2S)-2-amino-4-methylsulfanyl-N-(4-nitrophenyl)butanamide |
| InChIKey | PLBWRAWSHVJPTL-JTQLQIEISA-N |
| SMILES | CSCC[C@@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)