Products 923128-18-1
CAS 923128-18-1 is the registry number for N,N,1-Trimethyl-3-oxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N,N,1-trimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide (CAS 923128-18-1) is a chemical compound with the molecular formula C11H15N3O3S and a molecular weight of 269.32 g/mol. IUPAC name: N,N,1-trimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide. InChIKey: OTSNVTAUVFGHLU-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O3S |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | N,N,1-trimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide |
| InChIKey | OTSNVTAUVFGHLU-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)NC2=C1C=CC(=C2)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)