CAS 735322-66-4 is the registry number for 4-(Pyrrolidine-1-sulfonyl)benzohydrazide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-pyrrolidin-1-ylsulfonylbenzohydrazide (CAS 735322-66-4) is a chemical compound with the molecular formula C11H15N3O3S and a molecular weight of 269.32 g/mol. IUPAC name: 4-pyrrolidin-1-ylsulfonylbenzohydrazide. InChIKey: OJOMJVZSAFQXRT-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O3S |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | 4-pyrrolidin-1-ylsulfonylbenzohydrazide |
| InChIKey | OJOMJVZSAFQXRT-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC=C(C=C2)C(=O)NN |
Computed by PubChem (NCBI)