CAS 6050-53-9 is the registry number for 1-Hydroxy-3,3-dimethyl-1-phenylbutan-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-hydroxy-3,3-dimethyl-1-phenylbutan-2-one (CAS 6050-53-9) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 1-hydroxy-3,3-dimethyl-1-phenylbutan-2-one. InChIKey: OMCHIZWOLPZRHK-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 1-hydroxy-3,3-dimethyl-1-phenylbutan-2-one |
| InChIKey | OMCHIZWOLPZRHK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C(C1=CC=CC=C1)O |
Computed by PubChem (NCBI)